Products 1554504-76-5
CAS 1554504-76-5 appears in our catalog under these names: 3-(2-Methoxypyridin-4-yl)benzoic acid, 97%, 3–(2–Methoxypyridin–4–yl)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 10g.
3-(2-methoxy-4-pyridinyl)benzoic acid (CAS 1554504-76-5) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-(2-methoxy-4-pyridinyl)benzoic acid. InChIKey: TVLPAZCCWINVET-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-(2-methoxy-4-pyridinyl)benzoic acid |
| InChIKey | TVLPAZCCWINVET-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)