CAS 37021-63-9 appears in our catalog under these names: 4-Benzyl-2-nitrophenol, 95%, 4-Benzyl-2-nitrophenol, 95+%, 4-Benzyl-2-nitrophenol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-benzyl-2-nitrophenol (CAS 37021-63-9) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 4-benzyl-2-nitrophenol. InChIKey: NDIBMYMEBYRTTJ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 4-benzyl-2-nitrophenol |
| InChIKey | NDIBMYMEBYRTTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)