Products 117523-29-2
CAS 117523-29-2 appears in our catalog under these names: 3-(Benzyloxy)pyridine-2-carboxylicacid, 95%, 3-(Benzyloxy)pyridine-2-carboxylic acid, 97%, 3-(Benzyloxy)picolinic acid, 95+%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-phenylmethoxypyridine-2-carboxylic acid (CAS 117523-29-2) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-phenylmethoxypyridine-2-carboxylic acid. InChIKey: MWHFMAMJIYHCLW-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-phenylmethoxypyridine-2-carboxylic acid |
| InChIKey | MWHFMAMJIYHCLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)C(=O)O |
Computed by PubChem (NCBI)