cas: 284492-22-4 — see every product listed under this CAS number, including other names
3-(Boc-amino)-3-(3-nitrophenyl)propionic Acid, 95%, 95% (CAS 284492-22-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BE2X-1g |
| cas | 284492-22-4 |
| size | 1g |
| availability | 40.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid (CAS 284492-22-4) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid. InChIKey: VSSDZTCJXHBUGF-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid |
| InChIKey | VSSDZTCJXHBUGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)