cas: 1201-68-9 — see every product listed under this CAS number, including other names
3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole, 95%, 95% (CAS 1201-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QAY-100mg |
| cas | 1201-68-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1514.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole (CAS 1201-68-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: VEIXFEJMHJPUBS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole |
| InChIKey | VEIXFEJMHJPUBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)