cas: 1201-68-9 — see every product listed under this CAS number, including other names
3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole, 97% (CAS 1201-68-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | SEW02030CB |
| cas | 1201-68-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 108.94 Pln | |
| Thermo Scientific | 1g | 268.79 Pln | |
| Thermo Scientific | 5g | 992.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole (CAS 1201-68-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: VEIXFEJMHJPUBS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole |
| InChIKey | VEIXFEJMHJPUBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)