3-(Fmoc-amino)-2-phenylpropionic acid, 95%, 95%
cas: 683217-60-9 — see every product listed under this CAS number, including other names
3-(Fmoc-amino)-2-phenylpropionic acid, 95%, 95% (CAS 683217-60-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDSB-50mg |
| cas | 683217-60-9 |
| size | 50mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 395.60 Pln | |
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 500mg | 1168.40 Pln | |
| Chemat | 1g | 1485.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid (CAS 683217-60-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid. InChIKey: ZPTZPWOHBIHMIJ-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid |
| InChIKey | ZPTZPWOHBIHMIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2-phenylpropanoic acid, 3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-phenylpropanoic acid, 3-(Fmoc-amino)-2-phenylpropionic acid, Fmoc-(R,S)-3-amino-2-phenylpropionic acid, 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid, (+/-)-3-(Fmoc-amino)-2-phenylpropionic acid, Fmoc-beta2-DL-Homophe-OH, a-[(Fmoc-amino)methyl]benzeneacetic acid, (S)-3-(9H-Fluoren-9-ylmethoxycarbonylamino)-2-phenyl-propionic acid, 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenyl-propanoic Acid