cas: 683217-60-9 — see every product listed under this CAS number, including other names
Fmoc-(R,S)-3-amino-2-phenylpropionic acid, 95% (CAS 683217-60-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493393-250MG |
| cas | 683217-60-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2606.39 Pln | |
| Fluorochem | 5g | 11577.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid (CAS 683217-60-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid. InChIKey: ZPTZPWOHBIHMIJ-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid |
| InChIKey | ZPTZPWOHBIHMIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)