cas: 24195-02-6 — see every product listed under this CAS number, including other names
3-(METHOXYCARBONYL)PYRIDINE-2-CARBOXYLIC ACID, 98% (CAS 24195-02-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474773-250MG |
| cas | 24195-02-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1580.71 Pln | |
| Fluorochem | 500mg | 3106.22 Pln | |
| Fluorochem | 1g | 3121.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-methoxycarbonylpyridine-2-carboxylic acid (CAS 24195-02-6) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 3-methoxycarbonylpyridine-2-carboxylic acid. InChIKey: PRENKBUQKMUCHQ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-methoxycarbonylpyridine-2-carboxylic acid |
| InChIKey | PRENKBUQKMUCHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC=C1)C(=O)O |
Computed by PubChem (NCBI)