CAS 41221-47-0 appears in our catalog under these names: Methyl 3-isocyanatobenzoate, 98%, 3-(Methoxycarbonyl)phenyl isocyanate, 97% , 3-Carbomethoxyphenyl isocyanate, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g.
Methyl 3-isocyanatobenzoate (CAS 41221-47-0) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: methyl 3-isocyanatobenzoate. InChIKey: WBGWGERFPSYHDT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | methyl 3-isocyanatobenzoate |
| InChIKey | WBGWGERFPSYHDT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N=C=O |
Computed by PubChem (NCBI)