CAS 52395-92-3 is the registry number for 2-Methyl-1,3-benzoxazole-7-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
2-methyl-1,3-benzoxazole-7-carboxylic acid (CAS 52395-92-3) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-methyl-1,3-benzoxazole-7-carboxylic acid. InChIKey: KDPOFQJHFWJFCB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-methyl-1,3-benzoxazole-7-carboxylic acid |
| InChIKey | KDPOFQJHFWJFCB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC(=C2O1)C(=O)O |
Computed by PubChem (NCBI)