CAS 613-57-0 appears in our catalog under these names: 3-(Naphthalen-2-yl)-3-oxopropanenitrile, 95%, 95%, 2-Naphthoylacetonitrile, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-naphthalen-2-yl-3-oxopropanenitrile (CAS 613-57-0) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 3-naphthalen-2-yl-3-oxopropanenitrile. InChIKey: GTEKTBPHQPYBPS-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-naphthalen-2-yl-3-oxopropanenitrile |
| InChIKey | GTEKTBPHQPYBPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CC#N |
Computed by PubChem (NCBI)