CAS 939771-50-3 is the registry number for 3-Cyano-5-phenylphenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-hydroxy-5-phenylbenzonitrile (CAS 939771-50-3) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 3-hydroxy-5-phenylbenzonitrile. InChIKey: XBLWYBDRUBPMAI-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-hydroxy-5-phenylbenzonitrile |
| InChIKey | XBLWYBDRUBPMAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C#N)O |
Computed by PubChem (NCBI)