CAS 137863-68-4 appears in our catalog under these names: 2-(4-Hydroxyphenyl)benzonitrile, 96%, 4'-Hydroxy-(1,1'-biphenyl)-2-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
2-(4-hydroxyphenyl)benzonitrile (CAS 137863-68-4) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 2-(4-hydroxyphenyl)benzonitrile. InChIKey: HBPAPDGVCPVONJ-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)benzonitrile |
| InChIKey | HBPAPDGVCPVONJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)