Products 3096-57-9
CAS 3096-57-9 appears in our catalog under these names: 2–Amino–9–fluorenone, 2-Amino-9-fluorenone, 2-Amino-9-fluorenone, 98%, 2-Amino-9-fluorenone, >98.0%(HPLC), 2-amino-9H-fluoren-9-one. Offered by: GLPBio, Biosynth, Combi-blocks, TCI, Fluorochem. Available pack sizes: 1g, 25g, 5g, 15g.
2-aminofluoren-9-one (CAS 3096-57-9) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 2-aminofluoren-9-one. InChIKey: SJODITPGMMSNRF-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 2-aminofluoren-9-one |
| InChIKey | SJODITPGMMSNRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-9-fluorenone, 2-Amino-9H-fluoren-9-one, 2-Aminofluoren-9-one, 9H-Fluoren-9-one, 2-amino-, 2-Aminofluorenone, SJODITPGMMSNRF-UHFFFAOYSA-, 4-14-00-00306 (Beilstein Handbook Reference), InChI=1/C13H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7H,14H2, 9H-Fluoren-9-one, 2-amino- (9CI), 2-Amino-fluorenon