CAS 127703-35-9 is the registry number for 2-(4-Cyanophenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(2-hydroxyphenyl)benzonitrile (CAS 127703-35-9) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 4-(2-hydroxyphenyl)benzonitrile. InChIKey: QNZKGZMRMGIXKO-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-(2-hydroxyphenyl)benzonitrile |
| InChIKey | QNZKGZMRMGIXKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C#N)O |
Computed by PubChem (NCBI)