CAS 6344-62-3 appears in our catalog under these names: 1-Amino-9H-fluoren-9-one, 95%, 1-Amino-9-fluorenone, 1-Amino-9-fluorenone 95%, 1-AMINO-9-FLUORENONE, 97%, 1-Amino-9H-fluoren-9-one, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g, 0,5g, 10g, 100mg.
1-aminofluoren-9-one (CAS 6344-62-3) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 1-aminofluoren-9-one. InChIKey: KSEPMOMKAQKOSM-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1-aminofluoren-9-one |
| InChIKey | KSEPMOMKAQKOSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C(=CC=C3)N |
Computed by PubChem (NCBI)