CAS 18068-82-1 appears in our catalog under these names: 2-Phenylfuro[3,2-b]pyridine, 95%, 2-Phenylfuro(3,2-b)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
2-phenylfuro[3,2-b]pyridine (CAS 18068-82-1) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 2-phenylfuro[3,2-b]pyridine. InChIKey: IZQVYGNVFNSARJ-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 2-phenylfuro[3,2-b]pyridine |
| InChIKey | IZQVYGNVFNSARJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(O2)C=CC=N3 |
Computed by PubChem (NCBI)