cas: 1163-67-3 — see every product listed under this CAS number, including other names
3-(Phenylcarbamoyl)naphthalen-2-yl acetate (CAS 1163-67-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F722560-1G |
| cas | 1163-67-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 25g | 1466.17 Pln |
| delivery time | 3-4 weeks |
|---|
[3-(phenylcarbamoyl)naphthalen-2-yl] acetate (CAS 1163-67-3) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: [3-(phenylcarbamoyl)naphthalen-2-yl] acetate. InChIKey: CVJGNNYDVQYHEO-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | [3-(phenylcarbamoyl)naphthalen-2-yl] acetate |
| InChIKey | CVJGNNYDVQYHEO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=CC=CC=C2C=C1C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)