cas: 1163-67-3 — see every product listed under this CAS number, including other names
Naphthol AS acetate, 99%(LC-MS), 99%(LC-MS) (CAS 1163-67-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111C6N-5g |
| cas | 1163-67-3 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 117.20 Pln |
| purity | 99%(LC-MS) |
|---|---|
| delivery time | 3 weeks |
[3-(phenylcarbamoyl)naphthalen-2-yl] acetate (CAS 1163-67-3) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: [3-(phenylcarbamoyl)naphthalen-2-yl] acetate. InChIKey: CVJGNNYDVQYHEO-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | [3-(phenylcarbamoyl)naphthalen-2-yl] acetate |
| InChIKey | CVJGNNYDVQYHEO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=CC=CC=C2C=C1C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)