cas: 1003562-01-3 — see every product listed under this CAS number, including other names
3-(Phenylsulfonyl)pyrrolidine hydrochloride, 97%, 97% (CAS 1003562-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112P5-100mg |
| cas | 1003562-01-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 500mg | 232.40 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(benzenesulfonyl)pyrrolidine;hydrochloride (CAS 1003562-01-3) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: 3-(benzenesulfonyl)pyrrolidine;hydrochloride. InChIKey: MUMXFWPSGKJXFA-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | 3-(benzenesulfonyl)pyrrolidine;hydrochloride |
| InChIKey | MUMXFWPSGKJXFA-UHFFFAOYSA-N |
| SMILES | C1CNCC1S(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)