cas: 1003562-01-3 — see every product listed under this CAS number, including other names
3-(Phenylsulfonyl)pyrrolidine hydrochloride, 97% (CAS 1003562-01-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A723873-10g |
| cas | 1003562-01-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 3845.80 Pln | |
| AmBeed | 25g | 7608.58 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 2174.25 Pln | |
| Fluorochem | 10g | 3574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(benzenesulfonyl)pyrrolidine;hydrochloride (CAS 1003562-01-3) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: 3-(benzenesulfonyl)pyrrolidine;hydrochloride. InChIKey: MUMXFWPSGKJXFA-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | 3-(benzenesulfonyl)pyrrolidine;hydrochloride |
| InChIKey | MUMXFWPSGKJXFA-UHFFFAOYSA-N |
| SMILES | C1CNCC1S(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)