cas: 2792201-01-3 — see every product listed under this CAS number, including other names
3-(Pyrrolidin-1-yl)bicyclo[1.1.1]pentan-1-amine dihydrochloride, 95%, 95% (CAS 2792201-01-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch138O2U-25mg |
| cas | 2792201-01-3 |
| size | 25mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 626.00 Pln | |
| Chemat | 50mg | 1019.60 Pln | |
| Chemat | 100mg | 1691.60 Pln | |
| Chemat | 250mg | 2997.20 Pln | |
| Chemat | 500mg | 4350.80 Pln | |
| Chemat | 1g | 6189.20 Pln | |
| Chemat | 5g | 18443.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-pyrrolidin-1-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride (CAS 2792201-01-3) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: 3-pyrrolidin-1-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride. InChIKey: DEZCCZBAHSCCGY-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 3-pyrrolidin-1-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride |
| InChIKey | DEZCCZBAHSCCGY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C23CC(C2)(C3)N.Cl.Cl |
Computed by PubChem (NCBI)