cas: 24341-72-8 — see every product listed under this CAS number, including other names
3-(Thiophene-2-carboxamido)benzoic acid, 97% (CAS 24341-72-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg. Offered by: AmBeed, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A825403-5g |
| cas | 24341-72-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10095.40 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1961.25 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1547.60 Pln | |
| BLDpharm | 100mg | 558.72 Pln | |
| BLDpharm | 250mg | 830.84 Pln | |
| BLDpharm | 1g | 2108.17 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(thiophene-2-carbonylamino)benzoic acid (CAS 24341-72-8) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 3-(thiophene-2-carbonylamino)benzoic acid. InChIKey: JFACUNXDFKLILL-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 3-(thiophene-2-carbonylamino)benzoic acid |
| InChIKey | JFACUNXDFKLILL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)