cas: 86270-03-3 — see every product listed under this CAS number, including other names
3-(Trifluoromethoxy)benzoyl chloride, 97% (CAS 86270-03-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A527881-1g |
| cas | 86270-03-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 239.26 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 914.28 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(trifluoromethoxy)benzoyl chloride (CAS 86270-03-3) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 3-(trifluoromethoxy)benzoyl chloride. InChIKey: MGKIOAXLPYJSMU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 3-(trifluoromethoxy)benzoyl chloride |
| InChIKey | MGKIOAXLPYJSMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)