CAS 115754-20-6 appears in our catalog under these names: 3–chloro–4–(trifluoromethyl)benzoic acid, 3-Chloro-4-(trifluoromethyl)benzoic acid, 97% , 3-chloro-4-(trifluoromethyl)benzoic acid, 98%, 98%, 3-Chloro-4-(trifluoromethyl)benzoic acid, 97%, 3-Chloro-4-(trifluoromethyl)benzoic acid, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 100g.
3-chloro-4-(trifluoromethyl)benzoic acid (CAS 115754-20-6) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 3-chloro-4-(trifluoromethyl)benzoic acid. InChIKey: UDXPRKSPAZWHQN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethyl)benzoic acid |
| InChIKey | UDXPRKSPAZWHQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)