cas: 230305-81-4 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)-1H-pyrazolo[4,3-c]pyridine 98% (CAS 230305-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A740768-100mg |
| cas | 230305-81-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 331.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A740768 |
3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine (CAS 230305-81-4) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine. InChIKey: QVHPHQMHLWQWFX-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | QVHPHQMHLWQWFX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C(NN=C21)C(F)(F)F |
Computed by PubChem (NCBI)