cas: 230305-81-4 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)-1H-pyrazolo[4,3-c]pyridine, 98%, 98% (CAS 230305-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch129FMH-100mg |
| cas | 230305-81-4 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 261.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine (CAS 230305-81-4) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine. InChIKey: QVHPHQMHLWQWFX-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | QVHPHQMHLWQWFX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C(NN=C21)C(F)(F)F |
Computed by PubChem (NCBI)