cas: 760952-64-5 — see every product listed under this CAS number, including other names
3-[2-(2,5-Dioxo-2,5-dihydro-1h-pyrrol-1-yl)ethoxy]propanoic acid, 98%, 98% (CAS 760952-64-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICPA-100mg |
| cas | 760952-64-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2718.80 Pln | |
| Chemat | 10g | 4720.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid (CAS 760952-64-5) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid. InChIKey: YTZFUAXOTCJZHP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid |
| InChIKey | YTZFUAXOTCJZHP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCC(=O)O |
Computed by PubChem (NCBI)