cas: 760952-64-5 — see every product listed under this CAS number, including other names
Mal-PEG1-acid, 99.87% (CAS 760952-64-5) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 100 mg, 1 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-126960-10 g |
| cas | 760952-64-5 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 6886.31 Pln | |
| MedChemExpress | 5 g | 3863.06 Pln | |
| MedChemExpress | 100 mg | 407.93 Pln | |
| MedChemExpress | 1 g | 1174.19 Pln | |
| MedChemExpress | 250 mg | 505.45 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.87% |
3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid (CAS 760952-64-5) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid. InChIKey: YTZFUAXOTCJZHP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoic acid |
| InChIKey | YTZFUAXOTCJZHP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCC(=O)O |
Computed by PubChem (NCBI)