cas: 587-48-4 — see every product listed under this CAS number, including other names
3-Acetamidobenzoic Acid, >99.0%(HPLC)(T) (CAS 587-48-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0012-25G |
| cas | 587-48-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 172.43 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(HPLC)(T) |
3-acetamidobenzoic acid (CAS 587-48-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 3-acetamidobenzoic acid. InChIKey: RGDPZMQZWZMONQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 3-acetamidobenzoic acid |
| InChIKey | RGDPZMQZWZMONQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)