Products 54022-98-9

CAS 54022-98-9 is the registry number for 5-(3-Bromophenyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(3-bromophenyl)furan-2-carboxylic acid (CAS 54022-98-9) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 5-(3-bromophenyl)furan-2-carboxylic acid. InChIKey: ZUZJDYMSVLVAQW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrO3
Molecular weight267.07 g/mol
IUPAC name5-(3-bromophenyl)furan-2-carboxylic acid
InChIKeyZUZJDYMSVLVAQW-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Br)C2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)