Products 1235440-93-3
CAS 1235440-93-3 appears in our catalog under these names: 3-(5-Bromo-2-furyl)benzoic acid, 96%, 3-(5-Bromo-2-furyl)benzoic acid, 96%, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
3-(5-bromofuran-2-yl)benzoic acid (CAS 1235440-93-3) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 3-(5-bromofuran-2-yl)benzoic acid. InChIKey: NIGZJALMSBKBEV-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 3-(5-bromofuran-2-yl)benzoic acid |
| InChIKey | NIGZJALMSBKBEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)