CAS 180411-11-4 is the registry number for 6-Bromonaphtho[2,3-d][1,3]dioxol-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromobenzo[f][1,3]benzodioxol-5-ol (CAS 180411-11-4) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 6-bromobenzo[f][1,3]benzodioxol-5-ol. InChIKey: JGDCKWXWJMONMC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 6-bromobenzo[f][1,3]benzodioxol-5-ol |
| InChIKey | JGDCKWXWJMONMC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C=CC(=C3O)Br |
Computed by PubChem (NCBI)