cas: 1876-15-9 — see every product listed under this CAS number, including other names
3-Acetyl-quinoline-4-carboxylic acid, 98% (CAS 1876-15-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020324-50MG |
| cas | 1876-15-9 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 419.66 Pln | |
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 500mg | 1778.56 Pln | |
| Fluorochem | 1g | 2491.85 Pln | |
| Fluorochem | 2.5g | 6079.13 Pln | |
| Fluorochem | 5g | 10181.85 Pln | |
| Fluorochem | 10g | 15081.17 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-acetylquinoline-4-carboxylic acid (CAS 1876-15-9) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 3-acetylquinoline-4-carboxylic acid. InChIKey: QAATYLLDIDZHOJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 3-acetylquinoline-4-carboxylic acid |
| InChIKey | QAATYLLDIDZHOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C2=CC=CC=C2N=C1)C(=O)O |
Computed by PubChem (NCBI)