CAS 1000993-70-3 appears in our catalog under these names: 3-Amino-2-hydroxy-N,N-dimethylbenzamide Hydrochloride, 95%, 95%, 3-Amino-2-hydroxy-N,N-dimethylbenzamide hydrochloride, 95%,RG, 3-Amino-2-hydroxy-N,N-dimethylbenzamide hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-amino-2-hydroxy-N,N-dimethylbenzamide;hydrochloride (CAS 1000993-70-3) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 3-amino-2-hydroxy-N,N-dimethylbenzamide;hydrochloride. InChIKey: FBCSPFDJCKJTQV-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 3-amino-2-hydroxy-N,N-dimethylbenzamide;hydrochloride |
| InChIKey | FBCSPFDJCKJTQV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)