Products 92765-39-4

CAS 92765-39-4 is the registry number for N-(2-Aminoethyl)-2-hydroxybenzamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

N-(2-aminoethyl)-2-hydroxybenzamide;hydrochloride (CAS 92765-39-4) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: N-(2-aminoethyl)-2-hydroxybenzamide;hydrochloride. InChIKey: SNBOEMWUHFGLMN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2O2
Molecular weight216.66 g/mol
IUPAC nameN-(2-aminoethyl)-2-hydroxybenzamide;hydrochloride
InChIKeySNBOEMWUHFGLMN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NCCN)O.Cl

Computed by PubChem (NCBI)