CAS 131020-46-7 appears in our catalog under these names: 2-methyl-4,5,6,7-tetrahydro-1h-1,3-benzodiazole-5-carboxylic acid hydrochloride, 95%, 2-Methyl-4,5,6,7-tetrahydro-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg.
2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 131020-46-7) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: KGMLDOIDTRMKEK-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | KGMLDOIDTRMKEK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)CC(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)