CAS 1426827-13-5 appears in our catalog under these names: methyl 4,5,6,7-tetrahydro-1H-1,3-benzodiazole-5-carboxylate hydrochloride, 95%, Methyl 4,5,6,7-tetrahydro-1H-1,3-benzodiazole-5-carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
Methyl 4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylate;hydrochloride (CAS 1426827-13-5) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: methyl 4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylate;hydrochloride. InChIKey: CNIWNBLYCFGVMA-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | methyl 4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylate;hydrochloride |
| InChIKey | CNIWNBLYCFGVMA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2=C(C1)NC=N2.Cl |
Computed by PubChem (NCBI)