CAS 166943-39-1 appears in our catalog under these names: N-Methyl-4-nitrophenethylamine hydrochloride, 98%, N-Methyl-2-(4-nitrophenyl)ethanamine Hydrochloride, >95% (HPLC), N–methyl–2–(4–nitrophenyl)ethylamine hydrochloride, N-METHYL-4-NITROPHENETHYLAMINE HYDROCHL&, N-Methyl-4-nitrophenethylamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 100mg, 500mg, 50mg.
N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride (CAS 166943-39-1) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: VGJDSNZOPPZCTB-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | VGJDSNZOPPZCTB-UHFFFAOYSA-N |
| SMILES | CNCCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)