CAS 126257-07-6 appears in our catalog under these names: P-Amino-d-phenylalanine hydrochloride, 98%, (R)-2-Amino-3-(4-aminophenyl)propanoic acid xhydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
(2R)-2-amino-3-(4-aminophenyl)propanoic acid;hydrochloride (CAS 126257-07-6) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: (2R)-2-amino-3-(4-aminophenyl)propanoic acid;hydrochloride. InChIKey: ISCZSPZLBJLJGO-DDWIOCJRSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-aminophenyl)propanoic acid;hydrochloride |
| InChIKey | ISCZSPZLBJLJGO-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)N.Cl |
Computed by PubChem (NCBI)