CAS 131020-40-1 appears in our catalog under these names: 1-methyl-4,5,6,7-tetrahydro-1h-1,3-benzodiazole-5-carboxylic acid hydrochloride, 95%, 1-Methyl-4,5,6,7-tetrahydro-1H-benzo(d)imidazole-5-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-methyl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylic acid;hydrochloride (CAS 131020-40-1) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 1-methyl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylic acid;hydrochloride. InChIKey: FWOPAINGJQWABU-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 1-methyl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | FWOPAINGJQWABU-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1CCC(C2)C(=O)O.Cl |
Computed by PubChem (NCBI)