cas: 88831-43-0 — see every product listed under this CAS number, including other names
3-Amino-3-phenyl-propionic acid methyl ester, HCl, 95%+, 95%+ (CAS 88831-43-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115AC4-100mg |
| cas | 88831-43-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 842.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-3-phenylpropanoate;hydrochloride (CAS 88831-43-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-amino-3-phenylpropanoate;hydrochloride. InChIKey: GYKTZBZYSKZYDB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | GYKTZBZYSKZYDB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)