CAS 22838-46-6 appears in our catalog under these names: Methyl (3r)-3-amino-3-phenylpropanoate hydrochloride, 98%, (R)-Methyl 3-amino-3-phenylpropanoate hydrochloride, 97%, Methyl (3R)-3-amino-3-phenylpropanoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 25g.
Methyl (3R)-3-amino-3-phenylpropanoate;hydrochloride (CAS 22838-46-6) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl (3R)-3-amino-3-phenylpropanoate;hydrochloride. InChIKey: GYKTZBZYSKZYDB-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | GYKTZBZYSKZYDB-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)