CAS 88831-43-0 appears in our catalog under these names: 3-Amino-3-phenyl-propionic acid methyl ester hydrochloride, 98%, methyl 3-amino-3-phenylpropanoate hydrochloride, 3-Amino-3-phenyl-propionic acid methyl ester, HCl, 95%+, 95%+, methyl 3-amino-3-phenylpropanoate hydrochloride, 95+%, H-β-DL-Phe-OH HCl, 95+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g, 100mg, 250mg.
Methyl 3-amino-3-phenylpropanoate;hydrochloride (CAS 88831-43-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-amino-3-phenylpropanoate;hydrochloride. InChIKey: GYKTZBZYSKZYDB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | GYKTZBZYSKZYDB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)