cas: 22819-07-4 — see every product listed under this CAS number, including other names
3-Amino-5-benzyl-4H-1,2,4-triazole (CAS 22819-07-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009888-250MG |
| cas | 22819-07-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 5g | 1611.95 Pln | |
| Fluorochem | 10g | 2424.16 Pln |
| delivery time | 2-3 weeks |
|---|
5-benzyl-1H-1,2,4-triazol-3-amine (CAS 22819-07-4) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 5-benzyl-1H-1,2,4-triazol-3-amine. InChIKey: QGLMSZQOJZAPSZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-benzyl-1H-1,2,4-triazol-3-amine |
| InChIKey | QGLMSZQOJZAPSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NN2)N |
Computed by PubChem (NCBI)