cas: 22819-07-4 — see every product listed under this CAS number, including other names
3-Benzyl-1H-1,2,4-triazol-5-amine 97% (CAS 22819-07-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A365553-250mg |
| cas | 22819-07-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A365553 |
5-benzyl-1H-1,2,4-triazol-3-amine (CAS 22819-07-4) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 5-benzyl-1H-1,2,4-triazol-3-amine. InChIKey: QGLMSZQOJZAPSZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-benzyl-1H-1,2,4-triazol-3-amine |
| InChIKey | QGLMSZQOJZAPSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NN2)N |
Computed by PubChem (NCBI)