cas: 73259-81-1 — see every product listed under this CAS number, including other names
3-Amino-Boc-L-alanine, 97% (CAS 73259-81-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F0XQ-1g |
| cas | 73259-81-1 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 352.40 Pln | |
| Chemat | 100g | 626.00 Pln | |
| Chemat | 250g | 1403.60 Pln | |
| Chemat | 500g | 2668.80 Pln | |
| Chemat | 1kg | 5248.40 Pln | |
| Chemat | 5kg | 18926.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 73259-81-1) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)