3-BROMO-5-FLUORO-4-METHYLBENZOIC ACID, 98%
cas: 1191988-29-0 — see every product listed under this CAS number, including other names
3-BROMO-5-FLUORO-4-METHYLBENZOIC ACID, 98% (CAS 1191988-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F306879-1G |
| cas | 1191988-29-0 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 836.18 Pln | |
| Fluorochem | 25g | 3199.93 Pln | |
| Fluorochem | 100g | 9421.70 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 856.40 Pln | |
| Chemat | 25g | 1965.20 Pln | |
| Chemat | 100g | 7288.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3-bromo-5-fluoro-4-methylbenzoic acid (CAS 1191988-29-0) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-5-fluoro-4-methylbenzoic acid. InChIKey: KIOZXYDLEXQKKJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-5-fluoro-4-methylbenzoic acid |
| InChIKey | KIOZXYDLEXQKKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(=O)O)F |
Computed by PubChem (NCBI)