cas: 1191988-29-0 — see every product listed under this CAS number, including other names
3-BROMO-5-FLUORO-4-METHYLBENZOIC ACID, 98% (CAS 1191988-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306879-1G |
| cas | 1191988-29-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 25g | 3069.77 Pln | |
| Fluorochem | 100g | 9322.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-5-fluoro-4-methylbenzoic acid (CAS 1191988-29-0) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-5-fluoro-4-methylbenzoic acid. InChIKey: KIOZXYDLEXQKKJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-5-fluoro-4-methylbenzoic acid |
| InChIKey | KIOZXYDLEXQKKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(=O)O)F |
Computed by PubChem (NCBI)