Products 1191988-29-0
CAS 1191988-29-0 appears in our catalog under these names: 3-Bromo-5-fluoro-4-methylbenzoic acid, 95%, 3–Bromo–5–fluoro–4–methylbenzoic acid, 3-Bromo-5-fluoro-4-methylbenzoic acid 97%, 3-Bromo-5-fluoro-4-methylbenzoic acid, 98%, 98%, 3-BROMO-5-FLUORO-4-METHYLBENZOIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 100mg, 10g, 100g.
3-bromo-5-fluoro-4-methylbenzoic acid (CAS 1191988-29-0) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-5-fluoro-4-methylbenzoic acid. InChIKey: KIOZXYDLEXQKKJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-5-fluoro-4-methylbenzoic acid |
| InChIKey | KIOZXYDLEXQKKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(=O)O)F |
Computed by PubChem (NCBI)